وانیلین
{{Chembox| Verifiedfields = changed| Watchedfields = changed| verifiedrevid = 456486843| ImageFileL1 = Vanillin2.svg| ImageFileL1_Ref = | ImageNameL1 = Skeletal formula of a vanillin minor tautomer| ImageFileR1 = Vanillin-3d.png| ImageFileR1_Ref = | ImageNameR1 = Spacefill model of a vanillin minor tautomer| PIN = 4-Hydroxy-3-methoxybenzaldehyde| OtherNames = Vanillin[۱]
Methyl vanillin[۱]
Vanillic aldehyde[۲]|Section1=! style="background: #F8EABA; text-align: center;" colspan="2" | تانیملاییجیلار
|-
| سیایاس ثبت نومرهسی | 121-33-5 |- | پابکم | 1183 |- | کماسپایدر | 13860434 |- | UNII | CHI530446X |- | ئیسی نومرهسی | 204-465-2 |-
| MeSH | {{{MeSHName}}} |-
| ChEMBL | {{#if:13883|CHEMBL13883 |-
| RTECS number | YW5775000 |-
|
| 472792 |-
|
| 3596 |- | 3DMet | {{{3DMet}}} |- | جیمول-تصاویر سه بعدی | {{#if:c1(C=O)cc(OC)c(O)cc1|Image 1 |-
| align="center" colspan="2" |
c1(C=O)cc(OC)c(O)cc1
|-
| align="center" colspan="2" |
InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,8H,1H3
Key: MWOOGOJBHIARFG-UHFFFAOYSA-NInChI=1/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3
Key: MWOOGOJBHIARFG-UHFFFAOYAS
|-|Section2=! colspan=2 style="background: #f8eaba; text-align: center;" |خوصوصیّتلر
|-
|
| C8H8O3
|- | Molar mass
| ۱۵۲٫۱۵ g·mol−1
|- | Appearance | White crystals |- | Odor | Vanilla, Sweet, Balsamic, Pleasant |- | Density | 1.056 g cm−3 |- | Melting point | ۸۱ تا ۸۳ °C; ۱۷۸ تا ۱۸۱ °F; ۳۵۴ تا ۳۵۶ K
|- | Boiling point | ۲۸۵ °C (۵۴۵ °F; ۵۵۸ K)
|-
|
| 10 g dm−3 |-
| log P | 1.208 |- | Vapor pressure | >1 Pa |-
| Acidity (pKa)
| 7.781
|-
| Basicity (pKb)
| 6.216
|-|Section3=! colspan=2 style="background: #f8eaba; text-align: center;" |Structure
|- | ساختار بلوری | Monoclinic |-|Section4=! colspan=2 style="background: #f8eaba; text-align: center;" |Thermochemistry
|-
|
combustion (ΔcH
| −3.828 MJ mol−1 |-|Section5={{Chembox Hazards| ExternalSDS = hazard.com| GHSPictograms = | GHSSignalWord = وانیلین (اینگیلیسجه: Vanillin، روسجا: Ванилин، عربجه: فانيلين) بیر شیمیایی ماده. آغ، کریستال حالتینده تاپیلار. فنول کیمی تانینیر.
بیرده باخ[دَییشدیر]
قایناقلار[دَییشدیر]
اینگیلیسجه ویکیپدیاسینین ایشلدنلری طرفیندن یارانمیش«Vanillin»، مقالهسیندن گؤتورولوبدور.( ۲۹ نوْوامبر ۲۰۱۷ تاریخینده یوْخلانیلیبدیر).