آییراچ ناب پتاسیس
{{chembox| Verifiedfields = changed| Watchedfields = changed| verifiedrevid = 404448904| ImageFile = Petasis reagent V1.svg| ImageSize = 120px| ImageName = Structural formula of the Petasis reagent| ImageFile1 = Petasis-reagent-3D-balls.png| ImageSize1 = 120px | ImageName1 = Ball-and-stick model of the Petasis reagent| IUPACName = Bis(η5-cyclopentadienyl)dimethyltitanium| OtherNames = Dimethyltitanocene|Section1={{Chembox Identifiers| SMILES = C[Ti](C)(C)c.c1cccc1.c2cccc2| ChemSpiderID_Ref = | ChemSpiderID = 34981143| InChI = 1/2C5H5.2CH3.Ti/c2
آییراچ ناب پتاسیس (اینگیلیسجه: Petasis reagent, روسجا: Реагент Петасиса) بیر شیمیایی ماده.
بیرده باخ
[دَییشدیر]قایناقلار
[دَییشدیر]اینگیلیسجه ویکیپدیاسینین ایشلدنلری طرفیندن یارانمیش «Petasis reagent»، مقالهسیندن گؤتورولوبدور. (۲۹ نوْوامبر ۲۰۱۷ تاریخینده یوْخلانیلیبدیر).