پرش به محتوا

آییراچ ناب پتاسیس

ویکی‌پدیادان، آچیق بیلیک‌لیک‌دن

{{chembox| Verifiedfields = changed| Watchedfields = changed| verifiedrevid = 404448904| ImageFile = Petasis reagent V1.svg| ImageSize = 120px| ImageName = Structural formula of the Petasis reagent| ImageFile1 = Petasis-reagent-3D-balls.png| ImageSize1 = 120px | ImageName1 = Ball-and-stick model of the Petasis reagent| IUPACName = Bis(η5-cyclopentadienyl)dimethyltitanium| OtherNames = Dimethyltitanocene|Section1={{Chembox Identifiers| SMILES = C[Ti](C)(C)c.c1cccc1.c2cccc2| ChemSpiderID_Ref =  N| ChemSpiderID = 34981143| InChI = 1/2C5H5.2CH3.Ti/c2

آییراچ ناب پتاسیس

آییراچ ناب پتاسیس (اینگیلیسجه: Petasis reagent, روسجا: Реагент Петасиса) بیر شیمیایی ماده.

بیرده باخ

[دَییشدیر]

قایناق‌لار

[دَییشدیر]

اینگیلیسجه ویکی‌پدیاسی‌نین ایشلدنلری طرفیندن یارانمیش «Petasis reagent»، مقاله‌سیندن گؤتورولوبدور. (۲۹ نوْوامبر ۲۰۱۷ تاریخینده یوْخلانیلیبدیر).

قارداش پروژه‌لرده آییراچ ناب پتاسیس گؤره داها آرتیق بیلگی‌لر تاپابیلرسینیز.


Search Commons فایل‌لار ویکی‌آمباردا